C17H14FN3O — CID 140531747
2-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetaldehyde (PubChem CID 140531747) has the molecular formula C17H14FN3O and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetaldehyde.
| Compound Name | 2-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetaldehyde |
|---|---|
| PubChem CID | 140531747 |
| Molecular Formula | C17H14FN3O |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetaldehyde |
| SMILES | [N-]=[N+]=N[C@H]1c2cc(F)ccc2Cc2ccccc2[C@H]1CC=O |
| InChI | InChI=1S/C17H14FN3O/c18-13-6-5-12-9-11-3-1-2-4-14(11)15(7-8-22)17(20-21-19)16(12)10-13/h1-6,8,10,15,17H,7,9H2/t15-,17-/m1/s1 |
| InChIKey | KODYGBWHRMPPIB-NVXWUHKLSA-N |
| XLogP | 4.45 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|