C18H17FO — CID 91580718
(2R,9R)-6-fluoro-9-prop-2-enyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ol (PubChem CID 91580718) has the molecular formula C18H17FO and a molecular weight of 268.33 g/mol. Its IUPAC name is (2R,9R)-6-fluoro-9-prop-2-enyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ol.
| Compound Name | (2R,9R)-6-fluoro-9-prop-2-enyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ol |
|---|---|
| PubChem CID | 91580718 |
| Molecular Formula | C18H17FO |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (2R,9R)-6-fluoro-9-prop-2-enyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ol |
| SMILES | C=CC[C@@H]1Cc2ccccc2[C@@H](O)c2ccc(F)cc21 |
| InChI | InChI=1S/C18H17FO/c1-2-5-12-10-13-6-3-4-7-15(13)18(20)16-9-8-14(19)11-17(12)16/h2-4,6-9,11-12,18,20H,1,5,10H2/t12-,18-/m1/s1 |
| InChIKey | LGERDIPLSGCOOW-KZULUSFZSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|