C25H27FO3S — CID 143151836
2-[(9R)-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]ethanol;methyl 4-methylbenzenesulfinate (PubChem CID 143151836) has the molecular formula C25H27FO3S and a molecular weight of 426.55 g/mol. Its IUPAC name is 2-[(9R)-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]ethanol;methyl 4-methylbenzenesulfinate.
| Compound Name | 2-[(9R)-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]ethanol;methyl 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 143151836 |
| Molecular Formula | C25H27FO3S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[(9R)-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]ethanol;methyl 4-methylbenzenesulfinate |
| SMILES | COS(=O)c1ccc(C)cc1.OCC[C@H]1Cc2cc(F)ccc2Cc2ccccc21 |
| InChI | InChI=1S/C17H17FO.C8H10O2S/c18-16-6-5-12-9-13-3-1-2-4-17(13)14(7-8-19)10-15(12)11-16;1-7-3-5-8(6-4-7)11(9)10-2/h1-6,11,14,19H,7-10H2;3-6H,1-2H3/t14-;/m0./s1 |
| InChIKey | PDLGMIRHNBOIMU-UQKRIMTDSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |