C26H29FO4S — CID 143151846
2-(13-fluoro-2-methoxy-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)ethanol;methyl 4-methylbenzenesulfinate (PubChem CID 143151846) has the molecular formula C26H29FO4S and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-(13-fluoro-2-methoxy-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)ethanol;methyl 4-methylbenzenesulfinate.
| Compound Name | 2-(13-fluoro-2-methoxy-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)ethanol;methyl 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 143151846 |
| Molecular Formula | C26H29FO4S |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-(13-fluoro-2-methoxy-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)ethanol;methyl 4-methylbenzenesulfinate |
| SMILES | COC1c2ccc(F)cc2CC(CCO)c2ccccc21.COS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19FO2.C8H10O2S/c1-21-18-16-7-6-14(19)11-13(16)10-12(8-9-20)15-4-2-3-5-17(15)18;1-7-3-5-8(6-4-7)11(9)10-2/h2-7,11-12,18,20H,8-10H2,1H3;3-6H,1-2H3 |
| InChIKey | RKVGSOQCGWRIGP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |