C20H27FN2 — CID 143335823
N,N-dimethylmethanamine;2-[(9R)-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]ethanamine (PubChem CID 143335823) has the molecular formula C20H27FN2 and a molecular weight of 314.45 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-[(9R)-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]ethanamine.
| Compound Name | N,N-dimethylmethanamine;2-[(9R)-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]ethanamine |
|---|---|
| PubChem CID | 143335823 |
| Molecular Formula | C20H27FN2 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | N,N-dimethylmethanamine;2-[(9R)-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]ethanamine |
| SMILES | CN(C)C.NCC[C@H]1Cc2cc(F)ccc2Cc2ccccc21 |
| InChI | InChI=1S/C17H18FN.C3H9N/c18-16-6-5-12-9-13-3-1-2-4-17(13)14(7-8-19)10-15(12)11-16;1-4(2)3/h1-6,11,14H,7-10,19H2;1-3H3/t14-;/m0./s1 |
| InChIKey | JMSXXGBKCYVCCZ-UQKRIMTDSA-N |
| XLogP | 3.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |