C10H10N4O4S2 — CID 19594476
3-(1-methylimidazol-2-yl)sulfanyl-4-nitrobenzenesulfonamide (PubChem CID 19594476) has the molecular formula C10H10N4O4S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-(1-methylimidazol-2-yl)sulfanyl-4-nitrobenzenesulfonamide.
| Compound Name | 3-(1-methylimidazol-2-yl)sulfanyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 19594476 |
| Molecular Formula | C10H10N4O4S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 3-(1-methylimidazol-2-yl)sulfanyl-4-nitrobenzenesulfonamide |
| SMILES | Cn1ccnc1Sc1cc(S(N)(=O)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O4S2/c1-13-5-4-12-10(13)19-9-6-7(20(11,17)18)2-3-8(9)14(15)16/h2-6H,1H3,(H2,11,17,18) |
| InChIKey | YJNIJOMMDUURML-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|