C15H15O2S2- — CID 19596037
[4-methyl-3-(2-phenylethyl)phenyl]-oxido-oxo-sulfanylidene-λ6-sulfane (PubChem CID 19596037) has the molecular formula C15H15O2S2- and a molecular weight of 291.42 g/mol. Its IUPAC name is [4-methyl-3-(2-phenylethyl)phenyl]-oxido-oxo-sulfanylidene-λ6-sulfane.
| Compound Name | [4-methyl-3-(2-phenylethyl)phenyl]-oxido-oxo-sulfanylidene-λ6-sulfane |
|---|---|
| PubChem CID | 19596037 |
| Molecular Formula | C15H15O2S2- |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | [4-methyl-3-(2-phenylethyl)phenyl]-oxido-oxo-sulfanylidene-λ6-sulfane |
| SMILES | Cc1ccc(S(=O)([O-])=S)cc1CCc1ccccc1 |
| InChI | InChI=1S/C15H16O2S2/c1-12-7-10-15(19(16,17)18)11-14(12)9-8-13-5-3-2-4-6-13/h2-7,10-11H,8-9H2,1H3,(H,16,17,18)/p-1 |
| InChIKey | OUOPHCWRTODJFQ-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |