C14H17P — CID 175179195
2,5-dimethyl-3-(2-phenylethyl)-1H-phosphole (PubChem CID 175179195) has the molecular formula C14H17P and a molecular weight of 216.26 g/mol. Its IUPAC name is 2,5-dimethyl-3-(2-phenylethyl)-1H-phosphole.
| Compound Name | 2,5-dimethyl-3-(2-phenylethyl)-1H-phosphole |
|---|---|
| PubChem CID | 175179195 |
| Molecular Formula | C14H17P |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2,5-dimethyl-3-(2-phenylethyl)-1H-phosphole |
| SMILES | Cc1cc(CCc2ccccc2)c(C)[pH]1 |
| InChI | InChI=1S/C14H17P/c1-11-10-14(12(2)15-11)9-8-13-6-4-3-5-7-13/h3-7,10,15H,8-9H2,1-2H3 |
| InChIKey | OJBAEYKFRZQXAP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |