C16H18O2S2 — CID 21222479
hydroxy-[4-methyl-3-(3-phenylpropyl)phenyl]-oxo-sulfanylidene-λ6-sulfane (PubChem CID 21222479) has the molecular formula C16H18O2S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is hydroxy-[4-methyl-3-(3-phenylpropyl)phenyl]-oxo-sulfanylidene-λ6-sulfane.
| Compound Name | hydroxy-[4-methyl-3-(3-phenylpropyl)phenyl]-oxo-sulfanylidene-λ6-sulfane |
|---|---|
| PubChem CID | 21222479 |
| Molecular Formula | C16H18O2S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | hydroxy-[4-methyl-3-(3-phenylpropyl)phenyl]-oxo-sulfanylidene-λ6-sulfane |
| SMILES | Cc1ccc(S(=O)(O)=S)cc1CCCc1ccccc1 |
| InChI | InChI=1S/C16H18O2S2/c1-13-10-11-16(20(17,18)19)12-15(13)9-5-8-14-6-3-2-4-7-14/h2-4,6-7,10-12H,5,8-9H2,1H3,(H,17,18,19) |
| InChIKey | CTFFWLUZEFXBNS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |