C7H8F2OS — CID 19598264
S-cyclopent-2-en-1-yl 2,2-difluoroethanethioate (PubChem CID 19598264) has the molecular formula C7H8F2OS and a molecular weight of 178.20 g/mol. Its IUPAC name is S-cyclopent-2-en-1-yl 2,2-difluoroethanethioate.
| Compound Name | S-cyclopent-2-en-1-yl 2,2-difluoroethanethioate |
|---|---|
| PubChem CID | 19598264 |
| Molecular Formula | C7H8F2OS |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | S-cyclopent-2-en-1-yl 2,2-difluoroethanethioate |
| SMILES | O=C(SC1C=CCC1)C(F)F |
| InChI | InChI=1S/C7H8F2OS/c8-6(9)7(10)11-5-3-1-2-4-5/h1,3,5-6H,2,4H2 |
| InChIKey | ZXMVCXYLICQOME-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|