C8H13NOS — CID 11019319
S-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate (PubChem CID 11019319) has the molecular formula C8H13NOS and a molecular weight of 171.27 g/mol. Its IUPAC name is S-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate.
| Compound Name | S-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 11019319 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | S-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate |
| SMILES | CNC(=O)S[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C8H13NOS/c1-9-8(10)11-7-5-3-2-4-6-7/h3,5,7H,2,4,6H2,1H3,(H,9,10)/t7-/m1/s1 |
| InChIKey | GLHGPNGOHPLHMY-SSDOTTSWSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|