C20H25NO2 — CID 19600053
6-phenyl-1-(4,5,7,8-tetrahydrofuro[2,3-d]azepin-6-yl)hexan-1-one (PubChem CID 19600053) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is 6-phenyl-1-(4,5,7,8-tetrahydrofuro[2,3-d]azepin-6-yl)hexan-1-one.
| Compound Name | 6-phenyl-1-(4,5,7,8-tetrahydrofuro[2,3-d]azepin-6-yl)hexan-1-one |
|---|---|
| PubChem CID | 19600053 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 6-phenyl-1-(4,5,7,8-tetrahydrofuro[2,3-d]azepin-6-yl)hexan-1-one |
| SMILES | O=C(CCCCCc1ccccc1)N1CCc2ccoc2CC1 |
| InChI | InChI=1S/C20H25NO2/c22-20(10-6-2-5-9-17-7-3-1-4-8-17)21-14-11-18-13-16-23-19(18)12-15-21/h1,3-4,7-8,13,16H,2,5-6,9-12,14-15H2 |
| InChIKey | OLGPZFARWHHTJT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|