C15H18N2O2 — CID 19600563
2,3-dimethyl-4-[1-(pyridin-2-ylmethoxy)ethoxy]pyridine (PubChem CID 19600563) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,3-dimethyl-4-[1-(pyridin-2-ylmethoxy)ethoxy]pyridine.
| Compound Name | 2,3-dimethyl-4-[1-(pyridin-2-ylmethoxy)ethoxy]pyridine |
|---|---|
| PubChem CID | 19600563 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2,3-dimethyl-4-[1-(pyridin-2-ylmethoxy)ethoxy]pyridine |
| SMILES | Cc1nccc(OC(C)OCc2ccccn2)c1C |
| InChI | InChI=1S/C15H18N2O2/c1-11-12(2)16-9-7-15(11)19-13(3)18-10-14-6-4-5-8-17-14/h4-9,13H,10H2,1-3H3 |
| InChIKey | QUBFHSXTZYVZFP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|