C11H17NO3 — CID 67415336
2-(1,1-dimethoxypropan-2-yloxymethyl)pyridine (PubChem CID 67415336) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(1,1-dimethoxypropan-2-yloxymethyl)pyridine.
| Compound Name | 2-(1,1-dimethoxypropan-2-yloxymethyl)pyridine |
|---|---|
| PubChem CID | 67415336 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-(1,1-dimethoxypropan-2-yloxymethyl)pyridine |
| SMILES | COC(OC)C(C)OCc1ccccn1 |
| InChI | InChI=1S/C11H17NO3/c1-9(11(13-2)14-3)15-8-10-6-4-5-7-12-10/h4-7,9,11H,8H2,1-3H3 |
| InChIKey | WECKZARKEFDAKD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|