C16H17NO3S — CID 19611539
3-[(4-cyclopentyl-1,3-thiazol-2-yl)methoxy]benzoic acid (PubChem CID 19611539) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 3-[(4-cyclopentyl-1,3-thiazol-2-yl)methoxy]benzoic acid.
| Compound Name | 3-[(4-cyclopentyl-1,3-thiazol-2-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 19611539 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-[(4-cyclopentyl-1,3-thiazol-2-yl)methoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCc2nc(C3CCCC3)cs2)c1 |
| InChI | InChI=1S/C16H17NO3S/c18-16(19)12-6-3-7-13(8-12)20-9-15-17-14(10-21-15)11-4-1-2-5-11/h3,6-8,10-11H,1-2,4-5,9H2,(H,18,19) |
| InChIKey | FWELSAAAXVBUKX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |