C10H11F2N2NaO2 — CID 19616355
sodium (E)-4-(1-ethyl-3-methylpyrazol-4-yl)-1,1-difluoro-4-oxobut-2-en-2-olate (PubChem CID 19616355) has the molecular formula C10H11F2N2NaO2 and a molecular weight of 252.20 g/mol. Its IUPAC name is sodium (E)-4-(1-ethyl-3-methylpyrazol-4-yl)-1,1-difluoro-4-oxobut-2-en-2-olate.
| Compound Name | sodium (E)-4-(1-ethyl-3-methylpyrazol-4-yl)-1,1-difluoro-4-oxobut-2-en-2-olate |
|---|---|
| PubChem CID | 19616355 |
| Molecular Formula | C10H11F2N2NaO2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | sodium (E)-4-(1-ethyl-3-methylpyrazol-4-yl)-1,1-difluoro-4-oxobut-2-en-2-olate |
| SMILES | CCn1cc(C(=O)/C=C(/[O-])C(F)F)c(C)n1.[Na+] |
| InChI | InChI=1S/C10H12F2N2O2.Na/c1-3-14-5-7(6(2)13-14)8(15)4-9(16)10(11)12;/h4-5,10,16H,3H2,1-2H3;/q;+1/p-1/b9-4+; |
| InChIKey | KJRFRVHLGOICAP-JOKMOOFLSA-M |
| XLogP | -2.09 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|