C12H9N3O2S2 — CID 19618235
(5Z)-5-[[5-(pyrazol-1-ylmethyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 19618235) has the molecular formula C12H9N3O2S2 and a molecular weight of 291.36 g/mol. Its IUPAC name is (5Z)-5-[[5-(pyrazol-1-ylmethyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(pyrazol-1-ylmethyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19618235 |
| Molecular Formula | C12H9N3O2S2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | (5Z)-5-[[5-(pyrazol-1-ylmethyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C12H9N3O2S2/c16-11-10(19-12(18)14-11)6-8-2-3-9(17-8)7-15-5-1-4-13-15/h1-6H,7H2,(H,14,16,18)/b10-6- |
| InChIKey | KEEYBQGWJLCRNJ-POHAHGRESA-N |
| XLogP | 2.01 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|