C22H24N4O — CID 19624915
2-(1H-indol-3-yl)-N-[[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]methyl]ethanamine (PubChem CID 19624915) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]methyl]ethanamine.
| Compound Name | 2-(1H-indol-3-yl)-N-[[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 19624915 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[[4-methoxy-3-(pyrazol-1-ylmethyl)phenyl]methyl]ethanamine |
| SMILES | COc1ccc(CNCCc2c[nH]c3ccccc23)cc1Cn1cccn1 |
| InChI | InChI=1S/C22H24N4O/c1-27-22-8-7-17(13-19(22)16-26-12-4-10-25-26)14-23-11-9-18-15-24-21-6-3-2-5-20(18)21/h2-8,10,12-13,15,23-24H,9,11,14,16H2,1H3 |
| InChIKey | USUARPAMFNZTMT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|