C16H11FN4O2 — CID 19659771
N-(4-cyanophenyl)-N'-[(E)-(2-fluorophenyl)methylideneamino]oxamide (PubChem CID 19659771) has the molecular formula C16H11FN4O2 and a molecular weight of 310.29 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N'-[(E)-(2-fluorophenyl)methylideneamino]oxamide.
| Compound Name | N-(4-cyanophenyl)-N'-[(E)-(2-fluorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 19659771 |
| Molecular Formula | C16H11FN4O2 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-(4-cyanophenyl)-N'-[(E)-(2-fluorophenyl)methylideneamino]oxamide |
| SMILES | N#Cc1ccc(NC(=O)C(=O)N/N=C/c2ccccc2F)cc1 |
| InChI | InChI=1S/C16H11FN4O2/c17-14-4-2-1-3-12(14)10-19-21-16(23)15(22)20-13-7-5-11(9-18)6-8-13/h1-8,10H,(H,20,22)(H,21,23)/b19-10+ |
| InChIKey | FMFLSWOVDMIABZ-VXLYETTFSA-N |
| XLogP | 1.79 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|