C8H6F2N4O2S — CID 19683362
3,4-difluoro-N-(1,2,4-triazol-4-yl)benzenesulfonamide (PubChem CID 19683362) has the molecular formula C8H6F2N4O2S and a molecular weight of 260.23 g/mol. Its IUPAC name is 3,4-difluoro-N-(1,2,4-triazol-4-yl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(1,2,4-triazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 19683362 |
| Molecular Formula | C8H6F2N4O2S |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 3,4-difluoro-N-(1,2,4-triazol-4-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nn1cnnc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H6F2N4O2S/c9-7-2-1-6(3-8(7)10)17(15,16)13-14-4-11-12-5-14/h1-5,13H |
| InChIKey | VGXJIBJPVAGNOD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |