C34H37FN3O7+ — CID 19690041
[4-[(Z)-1,2-dicarboxyethenyl]benzoyl]-(dimethylamino)-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-(4-methoxyphenyl)azanium (PubChem CID 19690041) has the molecular formula C34H37FN3O7+ and a molecular weight of 618.68 g/mol. Its IUPAC name is [4-[(Z)-1,2-dicarboxyethenyl]benzoyl]-(dimethylamino)-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-(4-methoxyphenyl)azanium.
| Compound Name | [4-[(Z)-1,2-dicarboxyethenyl]benzoyl]-(dimethylamino)-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-(4-methoxyphenyl)azanium |
|---|---|
| PubChem CID | 19690041 |
| Molecular Formula | C34H37FN3O7+ |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | [4-[(Z)-1,2-dicarboxyethenyl]benzoyl]-(dimethylamino)-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-(4-methoxyphenyl)azanium |
| SMILES | COc1ccc([N+](CCN2CCC(C(=O)c3ccc(F)cc3)CC2)(C(=O)c2ccc(/C(=C/C(=O)O)C(=O)O)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C34H36FN3O7/c1-36(2)38(28-12-14-29(45-3)15-13-28,33(42)26-6-4-23(5-7-26)30(34(43)44)22-31(39)40)21-20-37-18-16-25(17-19-37)32(41)24-8-10-27(35)11-9-24/h4-15,22,25H,16-21H2,1-3H3,(H-,39,40,43,44)/p+1/b30-22- |
| InChIKey | LFVSCJNGRQHJAP-SWKFRHMKSA-O |
| XLogP | 4.61 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|