C24H28FN3O8S — CID 67801576
3-[4-(4-fluorobenzoyl)piperidin-1-yl]-N'-(4-methoxyphenyl)sulfonylpropanimidamide;oxalic acid (PubChem CID 67801576) has the molecular formula C24H28FN3O8S and a molecular weight of 537.57 g/mol. Its IUPAC name is 3-[4-(4-fluorobenzoyl)piperidin-1-yl]-N'-(4-methoxyphenyl)sulfonylpropanimidamide;oxalic acid.
| Compound Name | 3-[4-(4-fluorobenzoyl)piperidin-1-yl]-N'-(4-methoxyphenyl)sulfonylpropanimidamide;oxalic acid |
|---|---|
| PubChem CID | 67801576 |
| Molecular Formula | C24H28FN3O8S |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 3-[4-(4-fluorobenzoyl)piperidin-1-yl]-N'-(4-methoxyphenyl)sulfonylpropanimidamide;oxalic acid |
| SMILES | COc1ccc(S(=O)(=O)N=C(N)CCN2CCC(C(=O)c3ccc(F)cc3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H26FN3O4S.C2H2O4/c1-30-19-6-8-20(9-7-19)31(28,29)25-21(24)12-15-26-13-10-17(11-14-26)22(27)16-2-4-18(23)5-3-16;3-1(4)2(5)6/h2-9,17H,10-15H2,1H3,(H2,24,25);(H,3,4)(H,5,6) |
| InChIKey | CVVKIZYLZIJRRA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|