C20H32O4Si — CID 19690238
[4-[dimethyl(phenyl)silyl]-2-methylbutan-2-yl] 3-(2,2-dimethylpropyl)dioxirane-3-carboxylate (PubChem CID 19690238) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is [4-[dimethyl(phenyl)silyl]-2-methylbutan-2-yl] 3-(2,2-dimethylpropyl)dioxirane-3-carboxylate.
| Compound Name | [4-[dimethyl(phenyl)silyl]-2-methylbutan-2-yl] 3-(2,2-dimethylpropyl)dioxirane-3-carboxylate |
|---|---|
| PubChem CID | 19690238 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [4-[dimethyl(phenyl)silyl]-2-methylbutan-2-yl] 3-(2,2-dimethylpropyl)dioxirane-3-carboxylate |
| SMILES | CC(C)(C)CC1(C(=O)OC(C)(C)CC[Si](C)(C)c2ccccc2)OO1 |
| InChI | InChI=1S/C20H32O4Si/c1-18(2,3)15-20(23-24-20)17(21)22-19(4,5)13-14-25(6,7)16-11-9-8-10-12-16/h8-12H,13-15H2,1-7H3 |
| InChIKey | CFYCZACGVRQZAC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|