C18H13ClN2O6S — CID 19692182
2-[[6-(4-chlorophenyl)sulfonyl-3-hydroxyquinoline-2-carbonyl]amino]acetic acid (PubChem CID 19692182) has the molecular formula C18H13ClN2O6S and a molecular weight of 420.83 g/mol. Its IUPAC name is 2-[[6-(4-chlorophenyl)sulfonyl-3-hydroxyquinoline-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[6-(4-chlorophenyl)sulfonyl-3-hydroxyquinoline-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 19692182 |
| Molecular Formula | C18H13ClN2O6S |
| Molecular Weight | 420.83 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 2-[[6-(4-chlorophenyl)sulfonyl-3-hydroxyquinoline-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1nc2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2cc1O |
| InChI | InChI=1S/C18H13ClN2O6S/c19-11-1-3-12(4-2-11)28(26,27)13-5-6-14-10(7-13)8-15(22)17(21-14)18(25)20-9-16(23)24/h1-8,22H,9H2,(H,20,25)(H,23,24) |
| InChIKey | FXAFCZSXPGIQNG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.83 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |