About 2-benzothiophen-1-ol
2-benzothiophen-1-ol (PubChem CID 19698750) has the molecular formula C8H6OS
and a molecular weight of 150.20 g/mol. Its IUPAC name is 2-benzothiophen-1-ol.
Molecular Properties
| Compound Name | 2-benzothiophen-1-ol |
| PubChem CID | 19698750 |
| Molecular Formula | C8H6OS |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 2-benzothiophen-1-ol |
| SMILES | Oc1scc2ccccc12 |
| InChI | InChI=1S/C8H6OS/c9-8-7-4-2-1-3-6(7)5-10-8/h1-5,9H |
| InChIKey | QHVUCKHHXWHLPN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzothiophen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzothiophen-1-ol?
The IUPAC name of 2-benzothiophen-1-ol (CID 19698750) is 2-benzothiophen-1-ol.
What is the SMILES notation for 2-benzothiophen-1-ol?
The canonical SMILES for 2-benzothiophen-1-ol is Oc1scc2ccccc12.
What is the InChIKey of 2-benzothiophen-1-ol?
The InChIKey is QHVUCKHHXWHLPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6OS/c9-8-7-4-2-1-3-6(7)5-10-8/h1-5,9H.
What are the key properties of 2-benzothiophen-1-ol?
2-benzothiophen-1-ol has a molecular weight of 150.20 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzothiophen-1-ol is sourced from PubChem (CID 19698750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).