C32H26O6 — CID 19698768
1,3-benzodioxol-5-yl 3-(4-methoxyphenyl)-1-methyl-5-phenylmethoxy-1H-indene-2-carboxylate (PubChem CID 19698768) has the molecular formula C32H26O6 and a molecular weight of 506.55 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-(4-methoxyphenyl)-1-methyl-5-phenylmethoxy-1H-indene-2-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 3-(4-methoxyphenyl)-1-methyl-5-phenylmethoxy-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 19698768 |
| Molecular Formula | C32H26O6 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-(4-methoxyphenyl)-1-methyl-5-phenylmethoxy-1H-indene-2-carboxylate |
| SMILES | COc1ccc(C2=C(C(=O)Oc3ccc4c(c3)OCO4)C(C)c3ccc(OCc4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C32H26O6/c1-20-26-14-12-24(35-18-21-6-4-3-5-7-21)16-27(26)31(22-8-10-23(34-2)11-9-22)30(20)32(33)38-25-13-15-28-29(17-25)37-19-36-28/h3-17,20H,18-19H2,1-2H3 |
| InChIKey | GKUIOTMUKMVTSB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|