C10H14N4 — CID 19706099
2-pentyl-2,3-dihydro-1H-imidazole-4,5-dicarbonitrile (PubChem CID 19706099) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-pentyl-2,3-dihydro-1H-imidazole-4,5-dicarbonitrile.
| Compound Name | 2-pentyl-2,3-dihydro-1H-imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 19706099 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-pentyl-2,3-dihydro-1H-imidazole-4,5-dicarbonitrile |
| SMILES | CCCCCC1NC(C#N)=C(C#N)N1 |
| InChI | InChI=1S/C10H14N4/c1-2-3-4-5-10-13-8(6-11)9(7-12)14-10/h10,13-14H,2-5H2,1H3 |
| InChIKey | LAQODPJXRMPQPW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|