C11H15N3S — CID 87309589
2-(4-pentyl-1,3-thiazolidin-2-ylidene)propanedinitrile (PubChem CID 87309589) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-(4-pentyl-1,3-thiazolidin-2-ylidene)propanedinitrile.
| Compound Name | 2-(4-pentyl-1,3-thiazolidin-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 87309589 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-(4-pentyl-1,3-thiazolidin-2-ylidene)propanedinitrile |
| SMILES | CCCCCC1CSC(=C(C#N)C#N)N1 |
| InChI | InChI=1S/C11H15N3S/c1-2-3-4-5-10-8-15-11(14-10)9(6-12)7-13/h10,14H,2-5,8H2,1H3 |
| InChIKey | ADOXOZDZXUXCIW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|