(5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate

C12H16N2O3 — CID 67018084

IUPAC(5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate
SMILESCCCCCC1C(C#N)=CNC=C1OC(=O)O
InChIInChI=1S/C12H16N2O3/c1-2-3-4-5-10-9(6-13)7-14-8-11(10)17-12(15)16/h7-8,10,14H,2-5H2,1H3,(H,15,16)
InChIKeySNTJQOYMMXAZOL-UHFFFAOYSA-N
MW236.27 g/mol
LogP2.73
Rot. Bonds5

About (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate

(5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate (PubChem CID 67018084) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate.

Molecular Properties

Compound Name(5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate
PubChem CID67018084
Molecular FormulaC12H16N2O3
Molecular Weight236.27 g/mol
Exact Mass236.12
IUPAC Name(5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate
SMILESCCCCCC1C(C#N)=CNC=C1OC(=O)O
InChIInChI=1S/C12H16N2O3/c1-2-3-4-5-10-9(6-13)7-14-8-11(10)17-12(15)16/h7-8,10,14H,2-5H2,1H3,(H,15,16)
InChIKeySNTJQOYMMXAZOL-UHFFFAOYSA-N
XLogP2.73
TPSA82.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 52.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate?
The IUPAC name of (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate (CID 67018084) is (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate.
What is the SMILES notation for (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate?
The canonical SMILES for (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate is CCCCCC1C(C#N)=CNC=C1OC(=O)O.
What is the InChIKey of (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate?
The InChIKey is SNTJQOYMMXAZOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c1-2-3-4-5-10-9(6-13)7-14-8-11(10)17-12(15)16/h7-8,10,14H,2-5H2,1H3,(H,15,16).
What are the key properties of (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate?
(5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate has a molecular weight of 236.27 g/mol, XLogP of 2.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate is sourced from PubChem (CID 67018084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).