C12H16N2O3 — CID 67018084
(5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate (PubChem CID 67018084) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate.
| Compound Name | (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 67018084 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (5-cyano-4-pentyl-1,4-dihydropyridin-3-yl) hydrogen carbonate |
| SMILES | CCCCCC1C(C#N)=CNC=C1OC(=O)O |
| InChI | InChI=1S/C12H16N2O3/c1-2-3-4-5-10-9(6-13)7-14-8-11(10)17-12(15)16/h7-8,10,14H,2-5H2,1H3,(H,15,16) |
| InChIKey | SNTJQOYMMXAZOL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|