C17H24N2O4 — CID 19736905
2-amino-6-(phenylmethoxycarbonylamino)-2-prop-2-enylhexanoic acid (PubChem CID 19736905) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-amino-6-(phenylmethoxycarbonylamino)-2-prop-2-enylhexanoic acid.
| Compound Name | 2-amino-6-(phenylmethoxycarbonylamino)-2-prop-2-enylhexanoic acid |
|---|---|
| PubChem CID | 19736905 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-amino-6-(phenylmethoxycarbonylamino)-2-prop-2-enylhexanoic acid |
| SMILES | C=CCC(N)(CCCCNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H24N2O4/c1-2-10-17(18,15(20)21)11-6-7-12-19-16(22)23-13-14-8-4-3-5-9-14/h2-5,8-9H,1,6-7,10-13,18H2,(H,19,22)(H,20,21) |
| InChIKey | KTVAGUCXAGRKHQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|