C21H23Cl2N3O2 — CID 19742826
4-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)-5-chloro-2-[(3-chlorophenyl)methoxy]benzamide (PubChem CID 19742826) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 4-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)-5-chloro-2-[(3-chlorophenyl)methoxy]benzamide.
| Compound Name | 4-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)-5-chloro-2-[(3-chlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 19742826 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 4-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)-5-chloro-2-[(3-chlorophenyl)methoxy]benzamide |
| SMILES | Nc1cc(OCc2cccc(Cl)c2)c(C(=O)NC2CN3CCC2CC3)cc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O2/c22-15-3-1-2-13(8-15)12-28-20-10-18(24)17(23)9-16(20)21(27)25-19-11-26-6-4-14(19)5-7-26/h1-3,8-10,14,19H,4-7,11-12,24H2,(H,25,27) |
| InChIKey | MTQPFTMAPQNBPG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|