C22H25ClIN3O3 — CID 19883416
4-amino-5-chloro-N-[(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)methyl]-2-[(3-iodophenyl)methoxy]benzamide (PubChem CID 19883416) has the molecular formula C22H25ClIN3O3 and a molecular weight of 541.82 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)methyl]-2-[(3-iodophenyl)methoxy]benzamide.
| Compound Name | 4-amino-5-chloro-N-[(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)methyl]-2-[(3-iodophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 19883416 |
| Molecular Formula | C22H25ClIN3O3 |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | 4-amino-5-chloro-N-[(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)methyl]-2-[(3-iodophenyl)methoxy]benzamide |
| SMILES | Nc1cc(OCc2cccc(I)c2)c(C(=O)NCC2(O)CN3CCC2CC3)cc1Cl |
| InChI | InChI=1S/C22H25ClIN3O3/c23-18-9-17(20(10-19(18)25)30-11-14-2-1-3-16(24)8-14)21(28)26-12-22(29)13-27-6-4-15(22)5-7-27/h1-3,8-10,15,29H,4-7,11-13,25H2,(H,26,28) |
| InChIKey | VPMSSWVRHWMYGR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|