C21H31ClN4O3 — CID 19795990
4-amino-N-(1-azabicyclo[3.2.1]octan-5-ylmethyl)-5-chloro-2-[2-(diethylamino)-2-oxoethoxy]benzamide (PubChem CID 19795990) has the molecular formula C21H31ClN4O3 and a molecular weight of 422.96 g/mol. Its IUPAC name is 4-amino-N-(1-azabicyclo[3.2.1]octan-5-ylmethyl)-5-chloro-2-[2-(diethylamino)-2-oxoethoxy]benzamide.
| Compound Name | 4-amino-N-(1-azabicyclo[3.2.1]octan-5-ylmethyl)-5-chloro-2-[2-(diethylamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 19795990 |
| Molecular Formula | C21H31ClN4O3 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4-amino-N-(1-azabicyclo[3.2.1]octan-5-ylmethyl)-5-chloro-2-[2-(diethylamino)-2-oxoethoxy]benzamide |
| SMILES | CCN(CC)C(=O)COc1cc(N)c(Cl)cc1C(=O)NCC12CCCN(CC1)C2 |
| InChI | InChI=1S/C21H31ClN4O3/c1-3-26(4-2)19(27)12-29-18-11-17(23)16(22)10-15(18)20(28)24-13-21-6-5-8-25(14-21)9-7-21/h10-11H,3-9,12-14,23H2,1-2H3,(H,24,28) |
| InChIKey | AUTAPHGKHDEPNB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|