C16H22O6S — CID 19745482
1-[3-(4-hydroxyphenyl)sulfonylpropoxy]propyl 2-methylprop-2-enoate (PubChem CID 19745482) has the molecular formula C16H22O6S and a molecular weight of 342.41 g/mol. Its IUPAC name is 1-[3-(4-hydroxyphenyl)sulfonylpropoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 1-[3-(4-hydroxyphenyl)sulfonylpropoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19745482 |
| Molecular Formula | C16H22O6S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-[3-(4-hydroxyphenyl)sulfonylpropoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)OCCCS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H22O6S/c1-4-15(22-16(18)12(2)3)21-10-5-11-23(19,20)14-8-6-13(17)7-9-14/h6-9,15,17H,2,4-5,10-11H2,1,3H3 |
| InChIKey | GMSKEGBXIPJMNS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|