C30H31FN2O2S — CID 19747696
(E)-N-[2-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propylsulfanyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 19747696) has the molecular formula C30H31FN2O2S and a molecular weight of 502.66 g/mol. Its IUPAC name is (E)-N-[2-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propylsulfanyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propylsulfanyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 19747696 |
| Molecular Formula | C30H31FN2O2S |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (E)-N-[2-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propylsulfanyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccccc1SCCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H31FN2O2S/c31-26-14-12-24(13-15-26)30(35)25-17-20-33(21-18-25)19-6-22-36-28-10-5-4-9-27(28)32-29(34)16-11-23-7-2-1-3-8-23/h1-5,7-16,25H,6,17-22H2,(H,32,34)/b16-11+ |
| InChIKey | BTJRRGGKPDGEPB-LFIBNONCSA-N |
| XLogP | 6.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|