C20H19Cl3N2O4 — CID 19752943
4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-methylcarbamoyl]benzoic acid (PubChem CID 19752943) has the molecular formula C20H19Cl3N2O4 and a molecular weight of 457.74 g/mol. Its IUPAC name is 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-methylcarbamoyl]benzoic acid.
| Compound Name | 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 19752943 |
| Molecular Formula | C20H19Cl3N2O4 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-methylcarbamoyl]benzoic acid |
| SMILES | CCC(C)N(C(=O)c1cc(Cl)c(Cl)c(Cl)c1)N(C)C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H19Cl3N2O4/c1-4-11(2)25(19(27)14-9-15(21)17(23)16(22)10-14)24(3)18(26)12-5-7-13(8-6-12)20(28)29/h5-11H,4H2,1-3H3,(H,28,29) |
| InChIKey | SJOPPXZFFUKMAF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|