C22H27FO2S — CID 19764774
4-[3-(4-tert-butylphenyl)sulfanyl-5-fluorophenyl]-2-methyloxan-4-ol (PubChem CID 19764774) has the molecular formula C22H27FO2S and a molecular weight of 374.52 g/mol. Its IUPAC name is 4-[3-(4-tert-butylphenyl)sulfanyl-5-fluorophenyl]-2-methyloxan-4-ol.
| Compound Name | 4-[3-(4-tert-butylphenyl)sulfanyl-5-fluorophenyl]-2-methyloxan-4-ol |
|---|---|
| PubChem CID | 19764774 |
| Molecular Formula | C22H27FO2S |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-[3-(4-tert-butylphenyl)sulfanyl-5-fluorophenyl]-2-methyloxan-4-ol |
| SMILES | CC1CC(O)(c2cc(F)cc(Sc3ccc(C(C)(C)C)cc3)c2)CCO1 |
| InChI | InChI=1S/C22H27FO2S/c1-15-14-22(24,9-10-25-15)17-11-18(23)13-20(12-17)26-19-7-5-16(6-8-19)21(2,3)4/h5-8,11-13,15,24H,9-10,14H2,1-4H3 |
| InChIKey | SJWLMYGMBYJMGV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |