C11H16O2S2 — CID 54426789
(2S,4R)-2-methyl-4-(5-methylsulfanylthiophen-3-yl)oxan-4-ol (PubChem CID 54426789) has the molecular formula C11H16O2S2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (2S,4R)-2-methyl-4-(5-methylsulfanylthiophen-3-yl)oxan-4-ol.
| Compound Name | (2S,4R)-2-methyl-4-(5-methylsulfanylthiophen-3-yl)oxan-4-ol |
|---|---|
| PubChem CID | 54426789 |
| Molecular Formula | C11H16O2S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (2S,4R)-2-methyl-4-(5-methylsulfanylthiophen-3-yl)oxan-4-ol |
| SMILES | CSc1cc([C@@]2(O)CCO[C@@H](C)C2)cs1 |
| InChI | InChI=1S/C11H16O2S2/c1-8-6-11(12,3-4-13-8)9-5-10(14-2)15-7-9/h5,7-8,12H,3-4,6H2,1-2H3/t8-,11+/m0/s1 |
| InChIKey | WEQYEMKTBPVEIY-GZMMTYOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |