C20H23NO2S3 — CID 22860813
6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methyl-3,4-dihydroquinoline-2-thione (PubChem CID 22860813) has the molecular formula C20H23NO2S3 and a molecular weight of 405.61 g/mol. Its IUPAC name is 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methyl-3,4-dihydroquinoline-2-thione.
| Compound Name | 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methyl-3,4-dihydroquinoline-2-thione |
|---|---|
| PubChem CID | 22860813 |
| Molecular Formula | C20H23NO2S3 |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methyl-3,4-dihydroquinoline-2-thione |
| SMILES | C[C@H]1C[C@@](O)(c2csc(Sc3ccc4c(c3)CCC(=S)N4C)c2)CCO1 |
| InChI | InChI=1S/C20H23NO2S3/c1-13-11-20(22,7-8-23-13)15-10-19(25-12-15)26-16-4-5-17-14(9-16)3-6-18(24)21(17)2/h4-5,9-10,12-13,22H,3,6-8,11H2,1-2H3/t13-,20+/m0/s1 |
| InChIKey | LDQLSGNHBBCFEO-RNODOKPDSA-N |
| XLogP | 5.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|