About 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium
2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium (PubChem CID 19764990) has the molecular formula C17H36NO4P
and a molecular weight of 349.45 g/mol. Its IUPAC name is 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium.
Molecular Properties
| Compound Name | 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium |
| PubChem CID | 19764990 |
| Molecular Formula | C17H36NO4P |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium |
| SMILES | CCCC[PH+](CCCC)CCCC.CN(C)COC(=O)C(=O)[O-] |
| InChI | InChI=1S/C12H27P.C5H9NO4/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-6(2)3-10-5(9)4(7)8/h4-12H2,1-3H3;3H2,1-2H3,(H,7,8) |
| InChIKey | ZHWJGURHRFAWPT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium?
The IUPAC name of 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium (CID 19764990) is 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium.
What is the SMILES notation for 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium?
The canonical SMILES for 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium is CCCC[PH+](CCCC)CCCC.CN(C)COC(=O)C(=O)[O-].
What is the InChIKey of 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium?
The InChIKey is ZHWJGURHRFAWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.C5H9NO4/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-6(2)3-10-5(9)4(7)8/h4-12H2,1-3H3;3H2,1-2H3,(H,7,8).
What are the key properties of 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium?
2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium has a molecular weight of 349.45 g/mol, XLogP of 2.40, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dimethylamino)methoxy]-2-oxoacetate;tributylphosphanium is sourced from PubChem (CID 19764990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).