C21H25F2N — CID 19765443
3-[4-[1-(4-ethylcyclohexyl)ethyl]phenyl]-2,6-difluoropyridine (PubChem CID 19765443) has the molecular formula C21H25F2N and a molecular weight of 329.43 g/mol. Its IUPAC name is 3-[4-[1-(4-ethylcyclohexyl)ethyl]phenyl]-2,6-difluoropyridine.
| Compound Name | 3-[4-[1-(4-ethylcyclohexyl)ethyl]phenyl]-2,6-difluoropyridine |
|---|---|
| PubChem CID | 19765443 |
| Molecular Formula | C21H25F2N |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 3-[4-[1-(4-ethylcyclohexyl)ethyl]phenyl]-2,6-difluoropyridine |
| SMILES | CCC1CCC(C(C)c2ccc(-c3ccc(F)nc3F)cc2)CC1 |
| InChI | InChI=1S/C21H25F2N/c1-3-15-4-6-16(7-5-15)14(2)17-8-10-18(11-9-17)19-12-13-20(22)24-21(19)23/h8-16H,3-7H2,1-2H3 |
| InChIKey | ZSMWNYUQTVDYFQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|