C8H7Br2NO6S — CID 19767388
1-(2,4-dibromo-3-hydroxy-6-nitrophenyl)ethanesulfonic acid (PubChem CID 19767388) has the molecular formula C8H7Br2NO6S and a molecular weight of 405.02 g/mol. Its IUPAC name is 1-(2,4-dibromo-3-hydroxy-6-nitrophenyl)ethanesulfonic acid.
| Compound Name | 1-(2,4-dibromo-3-hydroxy-6-nitrophenyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 19767388 |
| Molecular Formula | C8H7Br2NO6S |
| Molecular Weight | 405.02 g/mol |
| Exact Mass | 402.84 |
| IUPAC Name | 1-(2,4-dibromo-3-hydroxy-6-nitrophenyl)ethanesulfonic acid |
| SMILES | CC(c1c([N+](=O)[O-])cc(Br)c(O)c1Br)S(=O)(=O)O |
| InChI | InChI=1S/C8H7Br2NO6S/c1-3(18(15,16)17)6-5(11(13)14)2-4(9)8(12)7(6)10/h2-3,12H,1H3,(H,15,16,17) |
| InChIKey | LPVCXVQPZDAWOO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.02 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|