About propane-1-sulfonate;tripropylazanium
propane-1-sulfonate;tripropylazanium (PubChem CID 19774866) has the molecular formula C12H29NO3S
and a molecular weight of 267.43 g/mol. Its IUPAC name is propane-1-sulfonate;tripropylazanium.
Molecular Properties
| Compound Name | propane-1-sulfonate;tripropylazanium |
| PubChem CID | 19774866 |
| Molecular Formula | C12H29NO3S |
| Molecular Weight | 267.43 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | propane-1-sulfonate;tripropylazanium |
| SMILES | CCCS(=O)(=O)[O-].CCC[NH+](CCC)CCC |
| InChI | InChI=1S/C9H21N.C3H8O3S/c1-4-7-10(8-5-2)9-6-3;1-2-3-7(4,5)6/h4-9H2,1-3H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | GYRHYGJCFDRHQF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze propane-1-sulfonate;tripropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1-sulfonate;tripropylazanium?
The IUPAC name of propane-1-sulfonate;tripropylazanium (CID 19774866) is propane-1-sulfonate;tripropylazanium.
What is the SMILES notation for propane-1-sulfonate;tripropylazanium?
The canonical SMILES for propane-1-sulfonate;tripropylazanium is CCCS(=O)(=O)[O-].CCC[NH+](CCC)CCC.
What is the InChIKey of propane-1-sulfonate;tripropylazanium?
The InChIKey is GYRHYGJCFDRHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C3H8O3S/c1-4-7-10(8-5-2)9-6-3;1-2-3-7(4,5)6/h4-9H2,1-3H3;2-3H2,1H3,(H,4,5,6).
What are the key properties of propane-1-sulfonate;tripropylazanium?
propane-1-sulfonate;tripropylazanium has a molecular weight of 267.43 g/mol, XLogP of 1.04, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1-sulfonate;tripropylazanium is sourced from PubChem (CID 19774866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).