C15H16N3O4S- — CID 19775567
2-[[5-[(4-nitrophenyl)methyl]-4-propyl-1,3-thiazol-2-yl]amino]acetate (PubChem CID 19775567) has the molecular formula C15H16N3O4S- and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[[5-[(4-nitrophenyl)methyl]-4-propyl-1,3-thiazol-2-yl]amino]acetate.
| Compound Name | 2-[[5-[(4-nitrophenyl)methyl]-4-propyl-1,3-thiazol-2-yl]amino]acetate |
|---|---|
| PubChem CID | 19775567 |
| Molecular Formula | C15H16N3O4S- |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-[[5-[(4-nitrophenyl)methyl]-4-propyl-1,3-thiazol-2-yl]amino]acetate |
| SMILES | CCCc1nc(NCC(=O)[O-])sc1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17N3O4S/c1-2-3-12-13(23-15(17-12)16-9-14(19)20)8-10-4-6-11(7-5-10)18(21)22/h4-7H,2-3,8-9H2,1H3,(H,16,17)(H,19,20)/p-1 |
| InChIKey | DCXDCOSFGIYXEZ-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|