C21H19N3O5S2 — CID 175246160
[4-[[2-acetamido-4-[(Z)-2-(4-nitrophenyl)ethenyl]-1,3-thiazol-5-yl]methyl]phenyl]methanesulfinic acid (PubChem CID 175246160) has the molecular formula C21H19N3O5S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is [4-[[2-acetamido-4-[(Z)-2-(4-nitrophenyl)ethenyl]-1,3-thiazol-5-yl]methyl]phenyl]methanesulfinic acid.
| Compound Name | [4-[[2-acetamido-4-[(Z)-2-(4-nitrophenyl)ethenyl]-1,3-thiazol-5-yl]methyl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 175246160 |
| Molecular Formula | C21H19N3O5S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [4-[[2-acetamido-4-[(Z)-2-(4-nitrophenyl)ethenyl]-1,3-thiazol-5-yl]methyl]phenyl]methanesulfinic acid |
| SMILES | CC(=O)Nc1nc(/C=C\c2ccc([N+](=O)[O-])cc2)c(Cc2ccc(CS(=O)O)cc2)s1 |
| InChI | InChI=1S/C21H19N3O5S2/c1-14(25)22-21-23-19(11-8-15-6-9-18(10-7-15)24(26)27)20(30-21)12-16-2-4-17(5-3-16)13-31(28)29/h2-11H,12-13H2,1H3,(H,28,29)(H,22,23,25)/b11-8- |
| InChIKey | FASCOPGGEYSRNH-FLIBITNWSA-N |
| XLogP | 4.49 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|