C20H22N4O5S — CID 91610545
methyl (3S)-1-[[2-acetamido-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-5-yl]methyl]pyrrolidine-3-carboxylate (PubChem CID 91610545) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is methyl (3S)-1-[[2-acetamido-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-5-yl]methyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[[2-acetamido-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-5-yl]methyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 91610545 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | methyl (3S)-1-[[2-acetamido-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-5-yl]methyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCN(Cc2sc(NC(C)=O)nc2C=Cc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C20H22N4O5S/c1-13(25)21-20-22-17(8-5-14-3-6-16(7-4-14)24(27)28)18(30-20)12-23-10-9-15(11-23)19(26)29-2/h3-8,15H,9-12H2,1-2H3,(H,21,22,25)/t15-/m0/s1 |
| InChIKey | VWEABJBFBMDTES-HNNXBMFYSA-N |
| XLogP | 3.17 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|