C18H19N5O4S — CID 91227231
N-[4-[2-(4-nitrophenyl)ethenyl]-5-[(3-oxopiperazin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 91227231) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is N-[4-[2-(4-nitrophenyl)ethenyl]-5-[(3-oxopiperazin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-(4-nitrophenyl)ethenyl]-5-[(3-oxopiperazin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 91227231 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[4-[2-(4-nitrophenyl)ethenyl]-5-[(3-oxopiperazin-1-yl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C=Cc2ccc([N+](=O)[O-])cc2)c(CN2CCNC(=O)C2)s1 |
| InChI | InChI=1S/C18H19N5O4S/c1-12(24)20-18-21-15(7-4-13-2-5-14(6-3-13)23(26)27)16(28-18)10-22-9-8-19-17(25)11-22/h2-7H,8-11H2,1H3,(H,19,25)(H,20,21,24) |
| InChIKey | RKIRCVSHSRPCOS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|