About N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide
N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 91007536) has the molecular formula C18H20N4O4S
and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 91007536 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C=Cc2ccc([N+](=O)[O-])cc2)c(CN2CCOCC2)s1 |
| InChI | InChI=1S/C18H20N4O4S/c1-13(23)19-18-20-16(17(27-18)12-21-8-10-26-11-9-21)7-4-14-2-5-15(6-3-14)22(24)25/h2-7H,8-12H2,1H3,(H,19,20,23) |
| InChIKey | XUMLMFUYBQTNME-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide (CID 91007536) is N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(C=Cc2ccc([N+](=O)[O-])cc2)c(CN2CCOCC2)s1.
What is the InChIKey of N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide?
The InChIKey is XUMLMFUYBQTNME-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O4S/c1-13(23)19-18-20-16(17(27-18)12-21-8-10-26-11-9-21)7-4-14-2-5-15(6-3-14)22(24)25/h2-7H,8-12H2,1H3,(H,19,20,23).
What are the key properties of N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide?
N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide has a molecular weight of 388.45 g/mol, XLogP of 3.01, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(morpholin-4-ylmethyl)-4-[2-(4-nitrophenyl)ethenyl]-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 91007536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).