C18H29NO6 — CID 19775823
4-[[1-(2-carboxy-3-methoxypropyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 19775823) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-[[1-(2-carboxy-3-methoxypropyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[1-(2-carboxy-3-methoxypropyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19775823 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-[[1-(2-carboxy-3-methoxypropyl)cyclopentanecarbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | COCC(CC1(C(=O)NC2CCC(C(=O)O)CC2)CCCC1)C(=O)O |
| InChI | InChI=1S/C18H29NO6/c1-25-11-13(16(22)23)10-18(8-2-3-9-18)17(24)19-14-6-4-12(5-7-14)15(20)21/h12-14H,2-11H2,1H3,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | GTZBDDCTVJZWLD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |