C24H39NO5 — CID 19775831
2-cyclohexyl-3-[1-[(4-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]propanoic acid (PubChem CID 19775831) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is 2-cyclohexyl-3-[1-[(4-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]propanoic acid.
| Compound Name | 2-cyclohexyl-3-[1-[(4-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 19775831 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 2-cyclohexyl-3-[1-[(4-ethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]propanoic acid |
| SMILES | CCOC(=O)C1CCC(NC(=O)C2(CC(C(=O)O)C3CCCCC3)CCCC2)CC1 |
| InChI | InChI=1S/C24H39NO5/c1-2-30-22(28)18-10-12-19(13-11-18)25-23(29)24(14-6-7-15-24)16-20(21(26)27)17-8-4-3-5-9-17/h17-20H,2-16H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | IYBXDMDFTIZEMF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |